C11H12ClN2O2+ — CID 123583660
ethyl 5-chloro-8-ethyl-2-aza-8-azoniabicyclo[4.2.0]octa-1(8),2,4,6-tetraene-4-carboxylate (PubChem CID 123583660) has the molecular formula C11H12ClN2O2+ and a molecular weight of 239.68 g/mol. Its IUPAC name is ethyl 5-chloro-8-ethyl-2-aza-8-azoniabicyclo[4.2.0]octa-1(8),2,4,6-tetraene-4-carboxylate.
| Compound Name | ethyl 5-chloro-8-ethyl-2-aza-8-azoniabicyclo[4.2.0]octa-1(8),2,4,6-tetraene-4-carboxylate |
|---|---|
| PubChem CID | 123583660 |
| Molecular Formula | C11H12ClN2O2+ |
| Molecular Weight | 239.68 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | ethyl 5-chloro-8-ethyl-2-aza-8-azoniabicyclo[4.2.0]octa-1(8),2,4,6-tetraene-4-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(c1Cl)=C[N+]=2CC |
| InChI | InChI=1S/C11H12ClN2O2/c1-3-14-6-8-9(12)7(5-13-10(8)14)11(15)16-4-2/h5-6H,3-4H2,1-2H3/q+1 |
| InChIKey | UVBMKGVTXHWKHO-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 42.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.68 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|