C11H13ClN3O2+ — CID 143062744
ethyl 4-chloro-1-ethyl-2H-pyrazolo[3,4-b]pyridin-1-ium-5-carboxylate (PubChem CID 143062744) has the molecular formula C11H13ClN3O2+ and a molecular weight of 254.70 g/mol. Its IUPAC name is ethyl 4-chloro-1-ethyl-2H-pyrazolo[3,4-b]pyridin-1-ium-5-carboxylate.
| Compound Name | ethyl 4-chloro-1-ethyl-2H-pyrazolo[3,4-b]pyridin-1-ium-5-carboxylate |
|---|---|
| PubChem CID | 143062744 |
| Molecular Formula | C11H13ClN3O2+ |
| Molecular Weight | 254.70 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | ethyl 4-chloro-1-ethyl-2H-pyrazolo[3,4-b]pyridin-1-ium-5-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(c[nH][n+]2CC)c1Cl |
| InChI | InChI=1S/C11H12ClN3O2/c1-3-15-10-7(6-14-15)9(12)8(5-13-10)11(16)17-4-2/h5-6H,3-4H2,1-2H3/p+1 |
| InChIKey | RCQMGWFLFNPCJC-UHFFFAOYSA-O |
| XLogP | 1.70 |
| TPSA | 58.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.70 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|