C17H36O4 — CID 123584128
5-methoxy-2-(2-methoxypropan-2-yloxy)-2,3,5,7-tetramethyloctan-4-ol (PubChem CID 123584128) has the molecular formula C17H36O4 and a molecular weight of 304.47 g/mol. Its IUPAC name is 5-methoxy-2-(2-methoxypropan-2-yloxy)-2,3,5,7-tetramethyloctan-4-ol.
| Compound Name | 5-methoxy-2-(2-methoxypropan-2-yloxy)-2,3,5,7-tetramethyloctan-4-ol |
|---|---|
| PubChem CID | 123584128 |
| Molecular Formula | C17H36O4 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.26 |
| IUPAC Name | 5-methoxy-2-(2-methoxypropan-2-yloxy)-2,3,5,7-tetramethyloctan-4-ol |
| SMILES | COC(C)(C)OC(C)(C)C(C)C(O)C(C)(CC(C)C)OC |
| InChI | InChI=1S/C17H36O4/c1-12(2)11-17(8,20-10)14(18)13(3)15(4,5)21-16(6,7)19-9/h12-14,18H,11H2,1-10H3 |
| InChIKey | KGPVMNYRYYHRBV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|