C11H24O4 — CID 90464397
1,2,4,4-tetramethoxy-2,3-dimethylpentane (PubChem CID 90464397) has the molecular formula C11H24O4 and a molecular weight of 220.31 g/mol. Its IUPAC name is 1,2,4,4-tetramethoxy-2,3-dimethylpentane.
| Compound Name | 1,2,4,4-tetramethoxy-2,3-dimethylpentane |
|---|---|
| PubChem CID | 90464397 |
| Molecular Formula | C11H24O4 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | 1,2,4,4-tetramethoxy-2,3-dimethylpentane |
| SMILES | COCC(C)(OC)C(C)C(C)(OC)OC |
| InChI | InChI=1S/C11H24O4/c1-9(11(3,14-6)15-7)10(2,13-5)8-12-4/h9H,8H2,1-7H3 |
| InChIKey | JNAJWEBKMFYREL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|