C13H30O2Si — CID 151267147
1,2-dimethoxypropan-2-yl-bis(2-methylpropyl)silane (PubChem CID 151267147) has the molecular formula C13H30O2Si and a molecular weight of 246.47 g/mol. Its IUPAC name is 1,2-dimethoxypropan-2-yl-bis(2-methylpropyl)silane.
| Compound Name | 1,2-dimethoxypropan-2-yl-bis(2-methylpropyl)silane |
|---|---|
| PubChem CID | 151267147 |
| Molecular Formula | C13H30O2Si |
| Molecular Weight | 246.47 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | 1,2-dimethoxypropan-2-yl-bis(2-methylpropyl)silane |
| SMILES | COCC(C)(OC)[SiH](CC(C)C)CC(C)C |
| InChI | InChI=1S/C13H30O2Si/c1-11(2)8-16(9-12(3)4)13(5,15-7)10-14-6/h11-12,16H,8-10H2,1-7H3 |
| InChIKey | NVOXIEHINHUTRE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|