C16H24ClN3O — CID 123584739
[3-chloro-4-(piperazin-1-ylmethyl)phenyl]-pyrrolidin-1-ylmethanol (PubChem CID 123584739) has the molecular formula C16H24ClN3O and a molecular weight of 309.84 g/mol. Its IUPAC name is [3-chloro-4-(piperazin-1-ylmethyl)phenyl]-pyrrolidin-1-ylmethanol.
| Compound Name | [3-chloro-4-(piperazin-1-ylmethyl)phenyl]-pyrrolidin-1-ylmethanol |
|---|---|
| PubChem CID | 123584739 |
| Molecular Formula | C16H24ClN3O |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | [3-chloro-4-(piperazin-1-ylmethyl)phenyl]-pyrrolidin-1-ylmethanol |
| SMILES | OC(c1ccc(CN2CCNCC2)c(Cl)c1)N1CCCC1 |
| InChI | InChI=1S/C16H24ClN3O/c17-15-11-13(16(21)20-7-1-2-8-20)3-4-14(15)12-19-9-5-18-6-10-19/h3-4,11,16,18,21H,1-2,5-10,12H2 |
| InChIKey | KJKYRDFACSKCBG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |