C11H15ClN2O — CID 143565225
N-[3-chloro-4-(pyrrolidin-1-ylmethyl)phenyl]hydroxylamine (PubChem CID 143565225) has the molecular formula C11H15ClN2O and a molecular weight of 226.71 g/mol. Its IUPAC name is N-[3-chloro-4-(pyrrolidin-1-ylmethyl)phenyl]hydroxylamine.
| Compound Name | N-[3-chloro-4-(pyrrolidin-1-ylmethyl)phenyl]hydroxylamine |
|---|---|
| PubChem CID | 143565225 |
| Molecular Formula | C11H15ClN2O |
| Molecular Weight | 226.71 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | N-[3-chloro-4-(pyrrolidin-1-ylmethyl)phenyl]hydroxylamine |
| SMILES | ONc1ccc(CN2CCCC2)c(Cl)c1 |
| InChI | InChI=1S/C11H15ClN2O/c12-11-7-10(13-15)4-3-9(11)8-14-5-1-2-6-14/h3-4,7,13,15H,1-2,5-6,8H2 |
| InChIKey | PXVBXAQZAHOUDC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.71 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|