About 4-(tert-butylamino)-8-(hydroxymethyl)-2,2-dimethyldecane-3,7-dione
4-(tert-butylamino)-8-(hydroxymethyl)-2,2-dimethyldecane-3,7-dione (PubChem CID 123585267) has the molecular formula C17H33NO3
and a molecular weight of 299.46 g/mol. Its IUPAC name is 4-(tert-butylamino)-8-(hydroxymethyl)-2,2-dimethyldecane-3,7-dione.
Molecular Properties
| Compound Name | 4-(tert-butylamino)-8-(hydroxymethyl)-2,2-dimethyldecane-3,7-dione |
| PubChem CID | 123585267 |
| Molecular Formula | C17H33NO3 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.25 |
| IUPAC Name | 4-(tert-butylamino)-8-(hydroxymethyl)-2,2-dimethyldecane-3,7-dione |
| SMILES | CCC(CO)C(=O)CCC(NC(C)(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C17H33NO3/c1-8-12(11-19)14(20)10-9-13(18-17(5,6)7)15(21)16(2,3)4/h12-13,18-19H,8-11H2,1-7H3 |
| InChIKey | RIXRVPLXJCOGEQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(tert-butylamino)-8-(hydroxymethyl)-2,2-dimethyldecane-3,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(tert-butylamino)-8-(hydroxymethyl)-2,2-dimethyldecane-3,7-dione?
The IUPAC name of 4-(tert-butylamino)-8-(hydroxymethyl)-2,2-dimethyldecane-3,7-dione (CID 123585267) is 4-(tert-butylamino)-8-(hydroxymethyl)-2,2-dimethyldecane-3,7-dione.
What is the SMILES notation for 4-(tert-butylamino)-8-(hydroxymethyl)-2,2-dimethyldecane-3,7-dione?
The canonical SMILES for 4-(tert-butylamino)-8-(hydroxymethyl)-2,2-dimethyldecane-3,7-dione is CCC(CO)C(=O)CCC(NC(C)(C)C)C(=O)C(C)(C)C.
What is the InChIKey of 4-(tert-butylamino)-8-(hydroxymethyl)-2,2-dimethyldecane-3,7-dione?
The InChIKey is RIXRVPLXJCOGEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H33NO3/c1-8-12(11-19)14(20)10-9-13(18-17(5,6)7)15(21)16(2,3)4/h12-13,18-19H,8-11H2,1-7H3.
What are the key properties of 4-(tert-butylamino)-8-(hydroxymethyl)-2,2-dimethyldecane-3,7-dione?
4-(tert-butylamino)-8-(hydroxymethyl)-2,2-dimethyldecane-3,7-dione has a molecular weight of 299.46 g/mol, XLogP of 2.73, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(tert-butylamino)-8-(hydroxymethyl)-2,2-dimethyldecane-3,7-dione is sourced from PubChem (CID 123585267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).