C23H28N6O8PS+ — CID 123586428
[(1R)-1-phenylethyl] 2-[[(3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy]-2-hydroxy-3H-1,3,2-thiazaphosphol-2-ium-4-carboxylate (PubChem CID 123586428) has the molecular formula C23H28N6O8PS+ and a molecular weight of 579.55 g/mol. Its IUPAC name is [(1R)-1-phenylethyl] 2-[[(3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy]-2-hydroxy-3H-1,3,2-thiazaphosphol-2-ium-4-carboxylate.
| Compound Name | [(1R)-1-phenylethyl] 2-[[(3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy]-2-hydroxy-3H-1,3,2-thiazaphosphol-2-ium-4-carboxylate |
|---|---|
| PubChem CID | 123586428 |
| Molecular Formula | C23H28N6O8PS+ |
| Molecular Weight | 579.55 g/mol |
| Exact Mass | 579.14 |
| IUPAC Name | [(1R)-1-phenylethyl] 2-[[(3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy]-2-hydroxy-3H-1,3,2-thiazaphosphol-2-ium-4-carboxylate |
| SMILES | COc1nc(N)nc2c1ncn2[C@@H]1OC(CO[P+]2(O)NC(C(=O)O[C@H](C)c3ccccc3)=CS2)[C@@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C23H28N6O8PS/c1-12(13-7-5-4-6-8-13)36-20(31)14-10-39-38(33,28-14)35-9-15-17(30)23(2,32)21(37-15)29-11-25-16-18(29)26-22(24)27-19(16)34-3/h4-8,10-12,15,17,21,28,30,32-33H,9H2,1-3H3,(H2,24,26,27)/q+1/t12-,15?,17-,21-,23-,38?/m1/s1 |
| InChIKey | UGBOENZTNRNKNP-YXSSDVRQSA-N |
| XLogP | 1.60 |
| TPSA | 196.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.55 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|