C24H31N6O8PS — CID 90383052
[(1R)-1-phenylethyl] (2S,4S)-2-[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy]-2-oxo-1,3,2λ5-thiazaphosphinane-4-carboxylate (PubChem CID 90383052) has the molecular formula C24H31N6O8PS and a molecular weight of 594.59 g/mol. Its IUPAC name is [(1R)-1-phenylethyl] (2S,4S)-2-[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy]-2-oxo-1,3,2λ5-thiazaphosphinane-4-carboxylate.
| Compound Name | [(1R)-1-phenylethyl] (2S,4S)-2-[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy]-2-oxo-1,3,2λ5-thiazaphosphinane-4-carboxylate |
|---|---|
| PubChem CID | 90383052 |
| Molecular Formula | C24H31N6O8PS |
| Molecular Weight | 594.59 g/mol |
| Exact Mass | 594.17 |
| IUPAC Name | [(1R)-1-phenylethyl] (2S,4S)-2-[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy]-2-oxo-1,3,2λ5-thiazaphosphinane-4-carboxylate |
| SMILES | COc1nc(N)nc2c1ncn2[C@@H]1O[C@H](CO[P@@]2(=O)N[C@H](C(=O)O[C@H](C)c3ccccc3)CCS2)[C@@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C24H31N6O8PS/c1-13(14-7-5-4-6-8-14)37-21(32)15-9-10-40-39(34,29-15)36-11-16-18(31)24(2,33)22(38-16)30-12-26-17-19(30)27-23(25)28-20(17)35-3/h4-8,12-13,15-16,18,22,31,33H,9-11H2,1-3H3,(H,29,34)(H2,25,27,28)/t13-,15+,16-,18-,22-,24-,39+/m1/s1 |
| InChIKey | BIRRUHRJAQBPLJ-BCXKWHNVSA-N |
| XLogP | 1.95 |
| TPSA | 193.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.59 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|