C22H27N6O8PS — CID 136645373
[(1R)-1-phenylethyl] (2R,4S)-2-[[(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy]-2-oxo-1,3,2λ5-thiazaphospholidine-4-carboxylate (PubChem CID 136645373) has the molecular formula C22H27N6O8PS and a molecular weight of 566.53 g/mol. Its IUPAC name is [(1R)-1-phenylethyl] (2R,4S)-2-[[(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy]-2-oxo-1,3,2λ5-thiazaphospholidine-4-carboxylate.
| Compound Name | [(1R)-1-phenylethyl] (2R,4S)-2-[[(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy]-2-oxo-1,3,2λ5-thiazaphospholidine-4-carboxylate |
|---|---|
| PubChem CID | 136645373 |
| Molecular Formula | C22H27N6O8PS |
| Molecular Weight | 566.53 g/mol |
| Exact Mass | 566.13 |
| IUPAC Name | [(1R)-1-phenylethyl] (2R,4S)-2-[[(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy]-2-oxo-1,3,2λ5-thiazaphospholidine-4-carboxylate |
| SMILES | C[C@@H](OC(=O)[C@H]1CS[P@](=O)(OC[C@H]2O[C@@H](n3cnc4c(=O)[nH]c(N)nc43)[C@](C)(O)[C@@H]2O)N1)c1ccccc1 |
| InChI | InChI=1S/C22H27N6O8PS/c1-11(12-6-4-3-5-7-12)35-19(31)13-9-38-37(33,27-13)34-8-14-16(29)22(2,32)20(36-14)28-10-24-15-17(28)25-21(23)26-18(15)30/h3-7,10-11,13-14,16,20,29,32H,8-9H2,1-2H3,(H,27,33)(H3,23,25,26,30)/t11-,13-,14-,16-,20-,22-,37-/m1/s1 |
| InChIKey | GBMDQIKICFSDQF-FNGHJNROSA-N |
| XLogP | 0.85 |
| TPSA | 203.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.53 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|