C23H28N5O8PS — CID 136645335
1-phenylethyl 2-[[(2R,3R,4R)-3,4-dihydroxy-4-methyl-5-(2-methyl-6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy]-2-oxo-1,3,2λ5-thiazaphospholidine-4-carboxylate (PubChem CID 136645335) has the molecular formula C23H28N5O8PS and a molecular weight of 565.55 g/mol. Its IUPAC name is 1-phenylethyl 2-[[(2R,3R,4R)-3,4-dihydroxy-4-methyl-5-(2-methyl-6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy]-2-oxo-1,3,2λ5-thiazaphospholidine-4-carboxylate.
| Compound Name | 1-phenylethyl 2-[[(2R,3R,4R)-3,4-dihydroxy-4-methyl-5-(2-methyl-6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy]-2-oxo-1,3,2λ5-thiazaphospholidine-4-carboxylate |
|---|---|
| PubChem CID | 136645335 |
| Molecular Formula | C23H28N5O8PS |
| Molecular Weight | 565.55 g/mol |
| Exact Mass | 565.14 |
| IUPAC Name | 1-phenylethyl 2-[[(2R,3R,4R)-3,4-dihydroxy-4-methyl-5-(2-methyl-6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy]-2-oxo-1,3,2λ5-thiazaphospholidine-4-carboxylate |
| SMILES | Cc1nc2c(ncn2C2O[C@H](COP3(=O)NC(C(=O)OC(C)c4ccccc4)CS3)[C@@H](O)[C@@]2(C)O)c(=O)[nH]1 |
| InChI | InChI=1S/C23H28N5O8PS/c1-12(14-7-5-4-6-8-14)35-21(31)15-10-38-37(33,27-15)34-9-16-18(29)23(3,32)22(36-16)28-11-24-17-19(28)25-13(2)26-20(17)30/h4-8,11-12,15-16,18,22,29,32H,9-10H2,1-3H3,(H,27,33)(H,25,26,30)/t12?,15?,16-,18-,22?,23-,37?/m1/s1 |
| InChIKey | LCGGSDNVKLJUMB-QXSSBSBPSA-N |
| XLogP | 1.57 |
| TPSA | 177.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.55 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|