C26H33N6O8PS — CID 90382931
cyclopentyl (4S)-2-[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy]-2-oxo-4,5-dihydro-3H-1,3,2λ5-benzothiazaphosphepine-4-carboxylate (PubChem CID 90382931) has the molecular formula C26H33N6O8PS and a molecular weight of 620.63 g/mol. Its IUPAC name is cyclopentyl (4S)-2-[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy]-2-oxo-4,5-dihydro-3H-1,3,2λ5-benzothiazaphosphepine-4-carboxylate.
| Compound Name | cyclopentyl (4S)-2-[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy]-2-oxo-4,5-dihydro-3H-1,3,2λ5-benzothiazaphosphepine-4-carboxylate |
|---|---|
| PubChem CID | 90382931 |
| Molecular Formula | C26H33N6O8PS |
| Molecular Weight | 620.63 g/mol |
| Exact Mass | 620.18 |
| IUPAC Name | cyclopentyl (4S)-2-[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy]-2-oxo-4,5-dihydro-3H-1,3,2λ5-benzothiazaphosphepine-4-carboxylate |
| SMILES | COc1nc(N)nc2c1ncn2[C@@H]1O[C@H](COP2(=O)N[C@H](C(=O)OC3CCCC3)Cc3ccccc3S2)[C@@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C26H33N6O8PS/c1-26(35)20(33)17(40-24(26)32-13-28-19-21(32)29-25(27)30-22(19)37-2)12-38-41(36)31-16(23(34)39-15-8-4-5-9-15)11-14-7-3-6-10-18(14)42-41/h3,6-7,10,13,15-17,20,24,33,35H,4-5,8-9,11-12H2,1-2H3,(H,31,36)(H2,27,29,30)/t16-,17+,20+,24+,26+,41?/m0/s1 |
| InChIKey | XULXLNIGKNCGOM-VWIRATJISA-N |
| XLogP | 2.34 |
| TPSA | 193.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.63 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|