C23H29N6O8PS — CID 90399139
[(1S)-1-phenylethyl] 2-[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy]-2-oxo-1,3,2λ5-thiazaphospholidine-4-carboxylate (PubChem CID 90399139) has the molecular formula C23H29N6O8PS and a molecular weight of 580.56 g/mol. Its IUPAC name is [(1S)-1-phenylethyl] 2-[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy]-2-oxo-1,3,2λ5-thiazaphospholidine-4-carboxylate.
| Compound Name | [(1S)-1-phenylethyl] 2-[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy]-2-oxo-1,3,2λ5-thiazaphospholidine-4-carboxylate |
|---|---|
| PubChem CID | 90399139 |
| Molecular Formula | C23H29N6O8PS |
| Molecular Weight | 580.56 g/mol |
| Exact Mass | 580.15 |
| IUPAC Name | [(1S)-1-phenylethyl] 2-[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy]-2-oxo-1,3,2λ5-thiazaphospholidine-4-carboxylate |
| SMILES | COc1nc(N)nc2c1ncn2[C@@H]1O[C@H](COP2(=O)NC(C(=O)O[C@@H](C)c3ccccc3)CS2)[C@@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C23H29N6O8PS/c1-12(13-7-5-4-6-8-13)36-20(31)14-10-39-38(33,28-14)35-9-15-17(30)23(2,32)21(37-15)29-11-25-16-18(29)26-22(24)27-19(16)34-3/h4-8,11-12,14-15,17,21,30,32H,9-10H2,1-3H3,(H,28,33)(H2,24,26,27)/t12-,14?,15+,17+,21+,23+,38?/m0/s1 |
| InChIKey | UBSKQYRONNPCKU-YGZHIILASA-N |
| XLogP | 1.56 |
| TPSA | 193.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.56 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|