C14H30N2O4Si — CID 123586830
N-[2-methyl-1-[2-methyl-2-(propanoylamino)propoxy]silyloxypropan-2-yl]propanamide (PubChem CID 123586830) has the molecular formula C14H30N2O4Si and a molecular weight of 318.49 g/mol. Its IUPAC name is N-[2-methyl-1-[2-methyl-2-(propanoylamino)propoxy]silyloxypropan-2-yl]propanamide.
| Compound Name | N-[2-methyl-1-[2-methyl-2-(propanoylamino)propoxy]silyloxypropan-2-yl]propanamide |
|---|---|
| PubChem CID | 123586830 |
| Molecular Formula | C14H30N2O4Si |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | N-[2-methyl-1-[2-methyl-2-(propanoylamino)propoxy]silyloxypropan-2-yl]propanamide |
| SMILES | CCC(=O)NC(C)(C)CO[SiH2]OCC(C)(C)NC(=O)CC |
| InChI | InChI=1S/C14H30N2O4Si/c1-7-11(17)15-13(3,4)9-19-21-20-10-14(5,6)16-12(18)8-2/h7-10,21H2,1-6H3,(H,15,17)(H,16,18) |
| InChIKey | BPPNCWWDWZONPN-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|