C13H26N4O3 — CID 154957249
N-[2-amino-2-methyl-1,1-bis(propanoylamino)propyl]propanamide (PubChem CID 154957249) has the molecular formula C13H26N4O3 and a molecular weight of 286.38 g/mol. Its IUPAC name is N-[2-amino-2-methyl-1,1-bis(propanoylamino)propyl]propanamide.
| Compound Name | N-[2-amino-2-methyl-1,1-bis(propanoylamino)propyl]propanamide |
|---|---|
| PubChem CID | 154957249 |
| Molecular Formula | C13H26N4O3 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | N-[2-amino-2-methyl-1,1-bis(propanoylamino)propyl]propanamide |
| SMILES | CCC(=O)NC(NC(=O)CC)(NC(=O)CC)C(C)(C)N |
| InChI | InChI=1S/C13H26N4O3/c1-6-9(18)15-13(12(4,5)14,16-10(19)7-2)17-11(20)8-3/h6-8,14H2,1-5H3,(H,15,18)(H,16,19)(H,17,20) |
| InChIKey | HHSNOQQFESUGKA-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|