C7H12N2 — CID 123590083
3,5-dimethyl-2,3-dihydropyridin-6-amine (PubChem CID 123590083) has the molecular formula C7H12N2 and a molecular weight of 124.19 g/mol. Its IUPAC name is 3,5-dimethyl-2,3-dihydropyridin-6-amine.
| Compound Name | 3,5-dimethyl-2,3-dihydropyridin-6-amine |
|---|---|
| PubChem CID | 123590083 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 3,5-dimethyl-2,3-dihydropyridin-6-amine |
| SMILES | CC1=CC(C)CN=C1N |
| InChI | InChI=1S/C7H12N2/c1-5-3-6(2)7(8)9-4-5/h3,5H,4H2,1-2H3,(H2,8,9) |
| InChIKey | QWKMGAIPFQHITQ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |