C24H50 — CID 123590734
6,10-diethyl-2,6,7,10,12-pentamethylpentadecane (PubChem CID 123590734) has the molecular formula C24H50 and a molecular weight of 338.66 g/mol. Its IUPAC name is 6,10-diethyl-2,6,7,10,12-pentamethylpentadecane.
| Compound Name | 6,10-diethyl-2,6,7,10,12-pentamethylpentadecane |
|---|---|
| PubChem CID | 123590734 |
| Molecular Formula | C24H50 |
| Molecular Weight | 338.66 g/mol |
| Exact Mass | 338.39 |
| IUPAC Name | 6,10-diethyl-2,6,7,10,12-pentamethylpentadecane |
| SMILES | CCCC(C)CC(C)(CC)CCC(C)C(C)(CC)CCCC(C)C |
| InChI | InChI=1S/C24H50/c1-10-14-21(6)19-23(8,11-2)18-16-22(7)24(9,12-3)17-13-15-20(4)5/h20-22H,10-19H2,1-9H3 |
| InChIKey | LDHLQESXTWJHJD-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.66 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |