C22H31F2N3O2 — CID 123590935
tert-butyl N-[1-(cyclopropen-1-ylmethylimino)-1-[(2,5-difluorophenyl)methylamino]-3,3-dimethylbutan-2-yl]carbamate (PubChem CID 123590935) has the molecular formula C22H31F2N3O2 and a molecular weight of 407.51 g/mol. Its IUPAC name is tert-butyl N-[1-(cyclopropen-1-ylmethylimino)-1-[(2,5-difluorophenyl)methylamino]-3,3-dimethylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(cyclopropen-1-ylmethylimino)-1-[(2,5-difluorophenyl)methylamino]-3,3-dimethylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 123590935 |
| Molecular Formula | C22H31F2N3O2 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | tert-butyl N-[1-(cyclopropen-1-ylmethylimino)-1-[(2,5-difluorophenyl)methylamino]-3,3-dimethylbutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(/C(=N\CC1=CC1)NCc1cc(F)ccc1F)C(C)(C)C |
| InChI | InChI=1S/C22H31F2N3O2/c1-21(2,3)18(27-20(28)29-22(4,5)6)19(25-12-14-7-8-14)26-13-15-11-16(23)9-10-17(15)24/h7,9-11,18H,8,12-13H2,1-6H3,(H,25,26)(H,27,28) |
| InChIKey | AXFOSVFDOKWOTC-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|