C24H23N3O4 — CID 123591022
benzyl N-[1-amino-2-(2-benzoyl-4-methylanilino)-2-oxoethyl]carbamate (PubChem CID 123591022) has the molecular formula C24H23N3O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is benzyl N-[1-amino-2-(2-benzoyl-4-methylanilino)-2-oxoethyl]carbamate.
| Compound Name | benzyl N-[1-amino-2-(2-benzoyl-4-methylanilino)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 123591022 |
| Molecular Formula | C24H23N3O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | benzyl N-[1-amino-2-(2-benzoyl-4-methylanilino)-2-oxoethyl]carbamate |
| SMILES | Cc1ccc(NC(=O)C(N)NC(=O)OCc2ccccc2)c(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C24H23N3O4/c1-16-12-13-20(19(14-16)21(28)18-10-6-3-7-11-18)26-23(29)22(25)27-24(30)31-15-17-8-4-2-5-9-17/h2-14,22H,15,25H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | NPXDFCNBVULOSU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|