C26H26N2O5S — CID 71518022
benzyl N-[(2S)-1-(2-benzoylanilino)-4-methylsulfinyl-1-oxobutan-2-yl]carbamate (PubChem CID 71518022) has the molecular formula C26H26N2O5S and a molecular weight of 478.57 g/mol. Its IUPAC name is benzyl N-[(2S)-1-(2-benzoylanilino)-4-methylsulfinyl-1-oxobutan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-(2-benzoylanilino)-4-methylsulfinyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 71518022 |
| Molecular Formula | C26H26N2O5S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | benzyl N-[(2S)-1-(2-benzoylanilino)-4-methylsulfinyl-1-oxobutan-2-yl]carbamate |
| SMILES | CS(=O)CC[C@H](NC(=O)OCc1ccccc1)C(=O)Nc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C26H26N2O5S/c1-34(32)17-16-23(28-26(31)33-18-19-10-4-2-5-11-19)25(30)27-22-15-9-8-14-21(22)24(29)20-12-6-3-7-13-20/h2-15,23H,16-18H2,1H3,(H,27,30)(H,28,31)/t23-,34?/m0/s1 |
| InChIKey | WNZSBBDMQQXRJA-SKBWGGTPSA-N |
| XLogP | 3.92 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |