C21H26BrN2O3S+ — CID 87071308
[4-(3-bromo-2-methylanilino)-4-oxo-3-(phenylmethoxycarbonylamino)butyl]-dimethylsulfanium (PubChem CID 87071308) has the molecular formula C21H26BrN2O3S+ and a molecular weight of 466.42 g/mol. Its IUPAC name is [4-(3-bromo-2-methylanilino)-4-oxo-3-(phenylmethoxycarbonylamino)butyl]-dimethylsulfanium.
| Compound Name | [4-(3-bromo-2-methylanilino)-4-oxo-3-(phenylmethoxycarbonylamino)butyl]-dimethylsulfanium |
|---|---|
| PubChem CID | 87071308 |
| Molecular Formula | C21H26BrN2O3S+ |
| Molecular Weight | 466.42 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | [4-(3-bromo-2-methylanilino)-4-oxo-3-(phenylmethoxycarbonylamino)butyl]-dimethylsulfanium |
| SMILES | Cc1c(Br)cccc1NC(=O)C(CC[S+](C)C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H25BrN2O3S/c1-15-17(22)10-7-11-18(15)23-20(25)19(12-13-28(2)3)24-21(26)27-14-16-8-5-4-6-9-16/h4-11,19H,12-14H2,1-3H3,(H-,23,24,25,26)/p+1 |
| InChIKey | WFFXWWIKGLKMEJ-UHFFFAOYSA-O |
| XLogP | 4.26 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|