C8H19NO3S — CID 123591167
5-hydroxy-N,2,4-trimethylpentane-2-sulfonamide (PubChem CID 123591167) has the molecular formula C8H19NO3S and a molecular weight of 209.31 g/mol. Its IUPAC name is 5-hydroxy-N,2,4-trimethylpentane-2-sulfonamide.
| Compound Name | 5-hydroxy-N,2,4-trimethylpentane-2-sulfonamide |
|---|---|
| PubChem CID | 123591167 |
| Molecular Formula | C8H19NO3S |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 5-hydroxy-N,2,4-trimethylpentane-2-sulfonamide |
| SMILES | CNS(=O)(=O)C(C)(C)CC(C)CO |
| InChI | InChI=1S/C8H19NO3S/c1-7(6-10)5-8(2,3)13(11,12)9-4/h7,9-10H,5-6H2,1-4H3 |
| InChIKey | NGPQJSPUWQNENP-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |