C49H27N3O — CID 123592740
2-[7-(12-isocyano-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaen-4-yl)pyren-2-yl]-4,6-diphenylpyrimidine (PubChem CID 123592740) has the molecular formula C49H27N3O and a molecular weight of 673.78 g/mol. Its IUPAC name is 2-[7-(12-isocyano-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaen-4-yl)pyren-2-yl]-4,6-diphenylpyrimidine.
| Compound Name | 2-[7-(12-isocyano-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaen-4-yl)pyren-2-yl]-4,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 123592740 |
| Molecular Formula | C49H27N3O |
| Molecular Weight | 673.78 g/mol |
| Exact Mass | 673.22 |
| IUPAC Name | 2-[7-(12-isocyano-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaen-4-yl)pyren-2-yl]-4,6-diphenylpyrimidine |
| SMILES | [C-]#[N+]c1ccc2c3c(cccc13)-c1cc(-c3cc4ccc5cc(-c6nc(-c7ccccc7)cc(-c7ccccc7)n6)cc6ccc(c3)c4c56)ccc1O2 |
| InChI | InChI=1S/C49H27N3O/c1-50-41-20-22-45-48-38(13-8-14-39(41)48)40-27-31(19-21-44(40)53-45)36-23-32-15-17-34-25-37(26-35-18-16-33(24-36)46(32)47(34)35)49-51-42(29-9-4-2-5-10-29)28-43(52-49)30-11-6-3-7-12-30/h2-28H |
| InChIKey | FLEDSZXWSNJPLM-UHFFFAOYSA-N |
| XLogP | 13.52 |
| TPSA | 39.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.78 |
| LogP ≤ 5 | 13.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|