C8H9NO2 — CID 123594441
3,4-bis(ethenyl)-1H-pyrrole-2,5-diol (PubChem CID 123594441) has the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. Its IUPAC name is 3,4-bis(ethenyl)-1H-pyrrole-2,5-diol.
| Compound Name | 3,4-bis(ethenyl)-1H-pyrrole-2,5-diol |
|---|---|
| PubChem CID | 123594441 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 3,4-bis(ethenyl)-1H-pyrrole-2,5-diol |
| SMILES | C=Cc1c(O)[nH]c(O)c1C=C |
| InChI | InChI=1S/C8H9NO2/c1-3-5-6(4-2)8(11)9-7(5)10/h3-4,9-11H,1-2H2 |
| InChIKey | YNZKADVYCBDUBB-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |