C24H18F3N5OS — CID 123598568
[2,6-difluoro-3-[(3-fluorophenyl)sulfanylamino]phenyl]-[5-(3-methyliminopropanimidoyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone (PubChem CID 123598568) has the molecular formula C24H18F3N5OS and a molecular weight of 481.50 g/mol. Its IUPAC name is [2,6-difluoro-3-[(3-fluorophenyl)sulfanylamino]phenyl]-[5-(3-methyliminopropanimidoyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone.
| Compound Name | [2,6-difluoro-3-[(3-fluorophenyl)sulfanylamino]phenyl]-[5-(3-methyliminopropanimidoyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone |
|---|---|
| PubChem CID | 123598568 |
| Molecular Formula | C24H18F3N5OS |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | [2,6-difluoro-3-[(3-fluorophenyl)sulfanylamino]phenyl]-[5-(3-methyliminopropanimidoyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone |
| SMILES | [H]/N=C(\C/C=N/C)c1cnc2[nH]cc(C(=O)c3c(F)ccc(NSc4cccc(F)c4)c3F)c2c1 |
| InChI | InChI=1S/C24H18F3N5OS/c1-29-8-7-19(28)13-9-16-17(12-31-24(16)30-11-13)23(33)21-18(26)5-6-20(22(21)27)32-34-15-4-2-3-14(25)10-15/h2-6,8-12,28,32H,7H2,1H3,(H,30,31)/b28-19+,29-8+ |
| InChIKey | SSKQPZJCFAFNRY-ZECHUKQQSA-N |
| XLogP | 5.79 |
| TPSA | 93.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|