C28H22F3N5OS — CID 123808842
[5-(4-amino-3-ethanimidoylphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-[2,6-difluoro-3-[(3-fluorocyclohexa-1,3-dien-1-yl)sulfanylamino]phenyl]methanone (PubChem CID 123808842) has the molecular formula C28H22F3N5OS and a molecular weight of 533.58 g/mol. Its IUPAC name is [5-(4-amino-3-ethanimidoylphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-[2,6-difluoro-3-[(3-fluorocyclohexa-1,3-dien-1-yl)sulfanylamino]phenyl]methanone.
| Compound Name | [5-(4-amino-3-ethanimidoylphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-[2,6-difluoro-3-[(3-fluorocyclohexa-1,3-dien-1-yl)sulfanylamino]phenyl]methanone |
|---|---|
| PubChem CID | 123808842 |
| Molecular Formula | C28H22F3N5OS |
| Molecular Weight | 533.58 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | [5-(4-amino-3-ethanimidoylphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-[2,6-difluoro-3-[(3-fluorocyclohexa-1,3-dien-1-yl)sulfanylamino]phenyl]methanone |
| SMILES | [H]/N=C(\C)c1cc(-c2cnc3[nH]cc(C(=O)c4c(F)ccc(NSC5=CC(F)=CCC5)c4F)c3c2)ccc1N |
| InChI | InChI=1S/C28H22F3N5OS/c1-14(32)19-9-15(5-7-23(19)33)16-10-20-21(13-35-28(20)34-12-16)27(37)25-22(30)6-8-24(26(25)31)36-38-18-4-2-3-17(29)11-18/h3,5-13,32,36H,2,4,33H2,1H3,(H,34,35)/b32-14+ |
| InChIKey | ZVIJYARGQCOKOD-HIWRWHBISA-N |
| XLogP | 7.30 |
| TPSA | 107.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.58 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|