C8H13N — CID 123600046
N-[(3E)-3-methylpenta-1,3-dien-2-yl]ethanimine (PubChem CID 123600046) has the molecular formula C8H13N and a molecular weight of 123.20 g/mol. Its IUPAC name is N-[(3E)-3-methylpenta-1,3-dien-2-yl]ethanimine.
| Compound Name | N-[(3E)-3-methylpenta-1,3-dien-2-yl]ethanimine |
|---|---|
| PubChem CID | 123600046 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | N-[(3E)-3-methylpenta-1,3-dien-2-yl]ethanimine |
| SMILES | C=C(/N=C/C)/C(C)=C/C |
| InChI | InChI=1S/C8H13N/c1-5-7(3)8(4)9-6-2/h5-6H,4H2,1-3H3/b7-5+,9-6+ |
| InChIKey | BPYHKCLWVNJWJN-PDTNFJSOSA-N |
| XLogP | 2.56 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|