C11H10FN — CID 142913217
N-[1-(2-fluorocyclohepta-1,3,4,6-tetraen-1-yl)ethenyl]ethanimine (PubChem CID 142913217) has the molecular formula C11H10FN and a molecular weight of 175.21 g/mol. Its IUPAC name is N-[1-(2-fluorocyclohepta-1,3,4,6-tetraen-1-yl)ethenyl]ethanimine.
| Compound Name | N-[1-(2-fluorocyclohepta-1,3,4,6-tetraen-1-yl)ethenyl]ethanimine |
|---|---|
| PubChem CID | 142913217 |
| Molecular Formula | C11H10FN |
| Molecular Weight | 175.21 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | N-[1-(2-fluorocyclohepta-1,3,4,6-tetraen-1-yl)ethenyl]ethanimine |
| SMILES | C=C(/N=C/C)C1=C(F)C=C=CC=C1 |
| InChI | InChI=1S/C11H10FN/c1-3-13-9(2)10-7-5-4-6-8-11(10)12/h3-5,7-8H,2H2,1H3/b13-3+ |
| InChIKey | REAFRLDBFGVMRU-QLKAYGNNSA-N |
| XLogP | 3.10 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.21 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|