C23H19FN4O3 — CID 123602146
4-[3-[4-[amino(hydroxy)methyl]-8-fluoroquinazolin-2-yl]phenyl]-2-(5-methyl-1,3-oxazol-2-yl)but-3-yn-2-ol (PubChem CID 123602146) has the molecular formula C23H19FN4O3 and a molecular weight of 418.43 g/mol. Its IUPAC name is 4-[3-[4-[amino(hydroxy)methyl]-8-fluoroquinazolin-2-yl]phenyl]-2-(5-methyl-1,3-oxazol-2-yl)but-3-yn-2-ol.
| Compound Name | 4-[3-[4-[amino(hydroxy)methyl]-8-fluoroquinazolin-2-yl]phenyl]-2-(5-methyl-1,3-oxazol-2-yl)but-3-yn-2-ol |
|---|---|
| PubChem CID | 123602146 |
| Molecular Formula | C23H19FN4O3 |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 4-[3-[4-[amino(hydroxy)methyl]-8-fluoroquinazolin-2-yl]phenyl]-2-(5-methyl-1,3-oxazol-2-yl)but-3-yn-2-ol |
| SMILES | Cc1cnc(C(C)(O)C#Cc2cccc(-c3nc(C(N)O)c4cccc(F)c4n3)c2)o1 |
| InChI | InChI=1S/C23H19FN4O3/c1-13-12-26-22(31-13)23(2,30)10-9-14-5-3-6-15(11-14)21-27-18-16(7-4-8-17(18)24)19(28-21)20(25)29/h3-8,11-12,20,29-30H,25H2,1-2H3 |
| InChIKey | BMALQWPDAROUHN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 118.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|