C13H25N — CID 123604365
N-but-3-en-2-yl-2,6-dimethylhept-5-en-3-amine (PubChem CID 123604365) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is N-but-3-en-2-yl-2,6-dimethylhept-5-en-3-amine.
| Compound Name | N-but-3-en-2-yl-2,6-dimethylhept-5-en-3-amine |
|---|---|
| PubChem CID | 123604365 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | N-but-3-en-2-yl-2,6-dimethylhept-5-en-3-amine |
| SMILES | C=CC(C)NC(CC=C(C)C)C(C)C |
| InChI | InChI=1S/C13H25N/c1-7-12(6)14-13(11(4)5)9-8-10(2)3/h7-8,11-14H,1,9H2,2-6H3 |
| InChIKey | OZQLFQJRHHUTAN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|