C11H18N2 — CID 123604432
N-methyl-1-(6-methyl-2-azabicyclo[3.1.0]hexan-3-yl)but-2-en-1-imine (PubChem CID 123604432) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is N-methyl-1-(6-methyl-2-azabicyclo[3.1.0]hexan-3-yl)but-2-en-1-imine.
| Compound Name | N-methyl-1-(6-methyl-2-azabicyclo[3.1.0]hexan-3-yl)but-2-en-1-imine |
|---|---|
| PubChem CID | 123604432 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | N-methyl-1-(6-methyl-2-azabicyclo[3.1.0]hexan-3-yl)but-2-en-1-imine |
| SMILES | CC=C/C(=N\C)C1CC2C(C)C2N1 |
| InChI | InChI=1S/C11H18N2/c1-4-5-9(12-3)10-6-8-7(2)11(8)13-10/h4-5,7-8,10-11,13H,6H2,1-3H3/b5-4?,12-9+ |
| InChIKey | LUJYEDWUNOXAJK-XIZFYRDISA-N |
| XLogP | 1.63 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|