C15H30N2 — CID 145104492
ethane;(Z)-N-methyl-2-piperidin-2-ylhept-4-en-3-imine (PubChem CID 145104492) has the molecular formula C15H30N2 and a molecular weight of 238.42 g/mol. Its IUPAC name is ethane;(Z)-N-methyl-2-piperidin-2-ylhept-4-en-3-imine.
| Compound Name | ethane;(Z)-N-methyl-2-piperidin-2-ylhept-4-en-3-imine |
|---|---|
| PubChem CID | 145104492 |
| Molecular Formula | C15H30N2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.24 |
| IUPAC Name | ethane;(Z)-N-methyl-2-piperidin-2-ylhept-4-en-3-imine |
| SMILES | CC.CC/C=C\C(=N/C)C(C)C1CCCCN1 |
| InChI | InChI=1S/C13H24N2.C2H6/c1-4-5-8-12(14-3)11(2)13-9-6-7-10-15-13;1-2/h5,8,11,13,15H,4,6-7,9-10H2,1-3H3;1-2H3/b8-5-,14-12+; |
| InChIKey | IEQSAKJKOIDEPZ-VKHHOHLBSA-N |
| XLogP | 3.83 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|