C16H34N2 — CID 144787952
(Z)-N-ethyl-2-piperidin-2-ylhex-4-en-3-imine;molecular hydrogen;propane (PubChem CID 144787952) has the molecular formula C16H34N2 and a molecular weight of 254.46 g/mol. Its IUPAC name is (Z)-N-ethyl-2-piperidin-2-ylhex-4-en-3-imine;molecular hydrogen;propane.
| Compound Name | (Z)-N-ethyl-2-piperidin-2-ylhex-4-en-3-imine;molecular hydrogen;propane |
|---|---|
| PubChem CID | 144787952 |
| Molecular Formula | C16H34N2 |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.27 |
| IUPAC Name | (Z)-N-ethyl-2-piperidin-2-ylhex-4-en-3-imine;molecular hydrogen;propane |
| SMILES | C/C=C\C(=N/CC)C(C)C1CCCCN1.CCC.[H][H] |
| InChI | InChI=1S/C13H24N2.C3H8.H2/c1-4-8-12(14-5-2)11(3)13-9-6-7-10-15-13;1-3-2;/h4,8,11,13,15H,5-7,9-10H2,1-3H3;3H2,1-2H3;1H/b8-4-,14-12+;; |
| InChIKey | VAHVODNOYBZTFI-JIQGOWIASA-N |
| XLogP | 4.46 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|