C7H11NO6P+ — CID 123606336
[3-carboxy-3-(methoxycarbonylamino)propyl]-formyl-oxophosphanium (PubChem CID 123606336) has the molecular formula C7H11NO6P+ and a molecular weight of 236.14 g/mol. Its IUPAC name is [3-carboxy-3-(methoxycarbonylamino)propyl]-formyl-oxophosphanium.
| Compound Name | [3-carboxy-3-(methoxycarbonylamino)propyl]-formyl-oxophosphanium |
|---|---|
| PubChem CID | 123606336 |
| Molecular Formula | C7H11NO6P+ |
| Molecular Weight | 236.14 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | [3-carboxy-3-(methoxycarbonylamino)propyl]-formyl-oxophosphanium |
| SMILES | COC(=O)NC(CC[P+](=O)C=O)C(=O)O |
| InChI | InChI=1S/C7H10NO6P/c1-14-7(12)8-5(6(10)11)2-3-15(13)4-9/h4-5H,2-3H2,1H3,(H-,8,10,11,12)/p+1 |
| InChIKey | BHPZKLXRHZPSCT-UHFFFAOYSA-O |
| XLogP | 0.20 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.14 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|