C15H30O6S — CID 123607022
2-[3-(2-ethylbutylsulfanyl)propoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 123607022) has the molecular formula C15H30O6S and a molecular weight of 338.47 g/mol. Its IUPAC name is 2-[3-(2-ethylbutylsulfanyl)propoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 2-[3-(2-ethylbutylsulfanyl)propoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 123607022 |
| Molecular Formula | C15H30O6S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 2-[3-(2-ethylbutylsulfanyl)propoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCC(CC)CSCCCOC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C15H30O6S/c1-3-10(4-2)9-22-7-5-6-20-15-14(19)13(18)12(17)11(8-16)21-15/h10-19H,3-9H2,1-2H3 |
| InChIKey | NVXXVDXRLZDLPP-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|