C28H10F6N6 — CID 123607248
4-[9-(4-isocyanophenyl)-6,13-bis(trifluoromethyl)-5,7,12,14-tetrazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4(16),5,7,9,11(15),12-octaen-2-yl]benzonitrile (PubChem CID 123607248) has the molecular formula C28H10F6N6 and a molecular weight of 544.42 g/mol. Its IUPAC name is 4-[9-(4-isocyanophenyl)-6,13-bis(trifluoromethyl)-5,7,12,14-tetrazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4(16),5,7,9,11(15),12-octaen-2-yl]benzonitrile.
| Compound Name | 4-[9-(4-isocyanophenyl)-6,13-bis(trifluoromethyl)-5,7,12,14-tetrazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4(16),5,7,9,11(15),12-octaen-2-yl]benzonitrile |
|---|---|
| PubChem CID | 123607248 |
| Molecular Formula | C28H10F6N6 |
| Molecular Weight | 544.42 g/mol |
| Exact Mass | 544.09 |
| IUPAC Name | 4-[9-(4-isocyanophenyl)-6,13-bis(trifluoromethyl)-5,7,12,14-tetrazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4(16),5,7,9,11(15),12-octaen-2-yl]benzonitrile |
| SMILES | [C-]#[N+]c1ccc(-c2cc3nc(C(F)(F)F)nc4c(-c5ccc(C#N)cc5)cc5nc(C(F)(F)F)nc2c5c34)cc1 |
| InChI | InChI=1S/C28H10F6N6/c1-36-16-8-6-15(7-9-16)18-11-20-21-22-19(37-26(28(32,33)34)40-24(18)22)10-17(14-4-2-13(12-35)3-5-14)23(21)39-25(38-20)27(29,30)31/h2-11H |
| InChIKey | NBSAQZMIBDDBJC-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 79.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.42 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'naphth_amino_A(25)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|