C23H43N2+ — CID 123607960
3-ethyl-N,N,3,6-tetramethyl-6-(1-methyl-2,3,4,5,6,7,8,9-octahydroazecin-1-ium-10-yl)hepta-1,4-dien-1-amine (PubChem CID 123607960) has the molecular formula C23H43N2+ and a molecular weight of 347.61 g/mol. Its IUPAC name is 3-ethyl-N,N,3,6-tetramethyl-6-(1-methyl-2,3,4,5,6,7,8,9-octahydroazecin-1-ium-10-yl)hepta-1,4-dien-1-amine.
| Compound Name | 3-ethyl-N,N,3,6-tetramethyl-6-(1-methyl-2,3,4,5,6,7,8,9-octahydroazecin-1-ium-10-yl)hepta-1,4-dien-1-amine |
|---|---|
| PubChem CID | 123607960 |
| Molecular Formula | C23H43N2+ |
| Molecular Weight | 347.61 g/mol |
| Exact Mass | 347.34 |
| IUPAC Name | 3-ethyl-N,N,3,6-tetramethyl-6-(1-methyl-2,3,4,5,6,7,8,9-octahydroazecin-1-ium-10-yl)hepta-1,4-dien-1-amine |
| SMILES | CCC(C)(C=CN(C)C)C=CC(C)(C)/C1=[N+](/C)CCCCCCCC1 |
| InChI | InChI=1S/C23H43N2/c1-8-23(4,18-20-24(5)6)17-16-22(2,3)21-15-13-11-9-10-12-14-19-25(21)7/h16-18,20H,8-15,19H2,1-7H3/q+1/b17-16?,20-18?,25-21- |
| InChIKey | LKAVMHABGKKPEJ-QIGBUAHASA-N |
| XLogP | 5.89 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.61 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|