C34H40N6O2 — CID 123608439
[4-[[8-[4-cyclohexa-1,5-dien-1-yl-4-(hydroxymethyl)piperidin-1-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]phenyl]-(2-penta-1,3-dien-3-ylpyrrolidin-1-yl)methanone (PubChem CID 123608439) has the molecular formula C34H40N6O2 and a molecular weight of 564.73 g/mol. Its IUPAC name is [4-[[8-[4-cyclohexa-1,5-dien-1-yl-4-(hydroxymethyl)piperidin-1-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]phenyl]-(2-penta-1,3-dien-3-ylpyrrolidin-1-yl)methanone.
| Compound Name | [4-[[8-[4-cyclohexa-1,5-dien-1-yl-4-(hydroxymethyl)piperidin-1-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]phenyl]-(2-penta-1,3-dien-3-ylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 123608439 |
| Molecular Formula | C34H40N6O2 |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.32 |
| IUPAC Name | [4-[[8-[4-cyclohexa-1,5-dien-1-yl-4-(hydroxymethyl)piperidin-1-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]phenyl]-(2-penta-1,3-dien-3-ylpyrrolidin-1-yl)methanone |
| SMILES | C=CC(=CC)C1CCCN1C(=O)c1ccc(Nc2nc3c(N4CCC(CO)(C5=CCCC=C5)CC4)cccn3n2)cc1 |
| InChI | InChI=1S/C34H40N6O2/c1-3-25(4-2)29-12-8-20-39(29)32(42)26-14-16-28(17-15-26)35-33-36-31-30(13-9-21-40(31)37-33)38-22-18-34(24-41,19-23-38)27-10-6-5-7-11-27/h3-4,6,9-11,13-17,21,29,41H,1,5,7-8,12,18-20,22-24H2,2H3,(H,35,37) |
| InChIKey | UZMMKZRBVRGXID-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 86.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|