C19H24O4 — CID 123608582
2-[2-(furan-2-yl)ethenyl]-3-(3-hydroxy-3-methylbutyl)-5,6-dimethylbenzene-1,4-diol (PubChem CID 123608582) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is 2-[2-(furan-2-yl)ethenyl]-3-(3-hydroxy-3-methylbutyl)-5,6-dimethylbenzene-1,4-diol.
| Compound Name | 2-[2-(furan-2-yl)ethenyl]-3-(3-hydroxy-3-methylbutyl)-5,6-dimethylbenzene-1,4-diol |
|---|---|
| PubChem CID | 123608582 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 2-[2-(furan-2-yl)ethenyl]-3-(3-hydroxy-3-methylbutyl)-5,6-dimethylbenzene-1,4-diol |
| SMILES | Cc1c(C)c(O)c(CCC(C)(C)O)c(C=Cc2ccco2)c1O |
| InChI | InChI=1S/C19H24O4/c1-12-13(2)18(21)16(9-10-19(3,4)22)15(17(12)20)8-7-14-6-5-11-23-14/h5-8,11,20-22H,9-10H2,1-4H3 |
| InChIKey | QSCOJAATDSZQQE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|