C31H54O3 — CID 91129139
2-[(3R,7R,11R)-3-hydroxy-3,7,11,15-tetramethylhexadec-1-enyl]-5,6-dimethyl-3-propylbenzene-1,4-diol (PubChem CID 91129139) has the molecular formula C31H54O3 and a molecular weight of 474.77 g/mol. Its IUPAC name is 2-[(3R,7R,11R)-3-hydroxy-3,7,11,15-tetramethylhexadec-1-enyl]-5,6-dimethyl-3-propylbenzene-1,4-diol.
| Compound Name | 2-[(3R,7R,11R)-3-hydroxy-3,7,11,15-tetramethylhexadec-1-enyl]-5,6-dimethyl-3-propylbenzene-1,4-diol |
|---|---|
| PubChem CID | 91129139 |
| Molecular Formula | C31H54O3 |
| Molecular Weight | 474.77 g/mol |
| Exact Mass | 474.41 |
| IUPAC Name | 2-[(3R,7R,11R)-3-hydroxy-3,7,11,15-tetramethylhexadec-1-enyl]-5,6-dimethyl-3-propylbenzene-1,4-diol |
| SMILES | CCCc1c(O)c(C)c(C)c(O)c1C=C[C@](C)(O)CCC[C@H](C)CCC[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C31H54O3/c1-9-13-27-28(30(33)26(7)25(6)29(27)32)19-21-31(8,34)20-12-18-24(5)17-11-16-23(4)15-10-14-22(2)3/h19,21-24,32-34H,9-18,20H2,1-8H3/t23-,24-,31-/m1/s1 |
| InChIKey | DRANRCJKLWJGMP-OVMXQCPESA-N |
| XLogP | 8.87 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.77 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|