C29H46O3 — CID 123641775
2-(3-hydroxy-3,7,11,15-tetramethylhexadeca-1,6,10-trienyl)-3,5,6-trimethylbenzene-1,4-diol (PubChem CID 123641775) has the molecular formula C29H46O3 and a molecular weight of 442.68 g/mol. Its IUPAC name is 2-(3-hydroxy-3,7,11,15-tetramethylhexadeca-1,6,10-trienyl)-3,5,6-trimethylbenzene-1,4-diol.
| Compound Name | 2-(3-hydroxy-3,7,11,15-tetramethylhexadeca-1,6,10-trienyl)-3,5,6-trimethylbenzene-1,4-diol |
|---|---|
| PubChem CID | 123641775 |
| Molecular Formula | C29H46O3 |
| Molecular Weight | 442.68 g/mol |
| Exact Mass | 442.34 |
| IUPAC Name | 2-(3-hydroxy-3,7,11,15-tetramethylhexadeca-1,6,10-trienyl)-3,5,6-trimethylbenzene-1,4-diol |
| SMILES | CC(=CCCC(C)(O)C=Cc1c(C)c(O)c(C)c(C)c1O)CCC=C(C)CCCC(C)C |
| InChI | InChI=1S/C29H46O3/c1-20(2)12-9-13-21(3)14-10-15-22(4)16-11-18-29(8,32)19-17-26-25(7)27(30)23(5)24(6)28(26)31/h14,16-17,19-20,30-32H,9-13,15,18H2,1-8H3 |
| InChIKey | ZMJVIMRRRLGMDW-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.68 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|