C29H43ClO2 — CID 90790566
2-(3-chloro-3,7,11,15-tetramethylhexadeca-1,6,10,14-tetraenyl)-3,5,6-trimethylbenzene-1,4-diol (PubChem CID 90790566) has the molecular formula C29H43ClO2 and a molecular weight of 459.11 g/mol. Its IUPAC name is 2-(3-chloro-3,7,11,15-tetramethylhexadeca-1,6,10,14-tetraenyl)-3,5,6-trimethylbenzene-1,4-diol.
| Compound Name | 2-(3-chloro-3,7,11,15-tetramethylhexadeca-1,6,10,14-tetraenyl)-3,5,6-trimethylbenzene-1,4-diol |
|---|---|
| PubChem CID | 90790566 |
| Molecular Formula | C29H43ClO2 |
| Molecular Weight | 459.11 g/mol |
| Exact Mass | 458.30 |
| IUPAC Name | 2-(3-chloro-3,7,11,15-tetramethylhexadeca-1,6,10,14-tetraenyl)-3,5,6-trimethylbenzene-1,4-diol |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC(C)(Cl)C=Cc1c(C)c(O)c(C)c(C)c1O |
| InChI | InChI=1S/C29H43ClO2/c1-20(2)12-9-13-21(3)14-10-15-22(4)16-11-18-29(8,30)19-17-26-25(7)27(31)23(5)24(6)28(26)32/h12,14,16-17,19,31-32H,9-11,13,15,18H2,1-8H3 |
| InChIKey | OESVLCDUVVOCKV-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.11 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|