C10H21N3 — CID 123608772
N,N,N'-trimethyl-N'-(4-methyliminobut-2-en-2-yl)ethane-1,2-diamine (PubChem CID 123608772) has the molecular formula C10H21N3 and a molecular weight of 183.30 g/mol. Its IUPAC name is N,N,N'-trimethyl-N'-(4-methyliminobut-2-en-2-yl)ethane-1,2-diamine.
| Compound Name | N,N,N'-trimethyl-N'-(4-methyliminobut-2-en-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 123608772 |
| Molecular Formula | C10H21N3 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.17 |
| IUPAC Name | N,N,N'-trimethyl-N'-(4-methyliminobut-2-en-2-yl)ethane-1,2-diamine |
| SMILES | C/N=C/C=C(C)N(C)CCN(C)C |
| InChI | InChI=1S/C10H21N3/c1-10(6-7-11-2)13(5)9-8-12(3)4/h6-7H,8-9H2,1-5H3/b10-6?,11-7+ |
| InChIKey | UDIZQJZTXHTSKR-DPWZYIFFSA-N |
| XLogP | 1.08 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|