C6H11NO4S — CID 123609347
3-hydroxy-2-(methoxycarbonylamino)butanethioic S-acid (PubChem CID 123609347) has the molecular formula C6H11NO4S and a molecular weight of 193.22 g/mol. Its IUPAC name is 3-hydroxy-2-(methoxycarbonylamino)butanethioic S-acid.
| Compound Name | 3-hydroxy-2-(methoxycarbonylamino)butanethioic S-acid |
|---|---|
| PubChem CID | 123609347 |
| Molecular Formula | C6H11NO4S |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.04 |
| IUPAC Name | 3-hydroxy-2-(methoxycarbonylamino)butanethioic S-acid |
| SMILES | COC(=O)NC(C(=O)S)C(C)O |
| InChI | InChI=1S/C6H11NO4S/c1-3(8)4(5(9)12)7-6(10)11-2/h3-4,8H,1-2H3,(H,7,10)(H,9,12) |
| InChIKey | QJBCCBJDFSRRAQ-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|