C8H15NO4S — CID 153093857
methyl N-[(2S,3S,5S)-2-hydroxy-4-oxo-5-sulfanylhexan-3-yl]carbamate (PubChem CID 153093857) has the molecular formula C8H15NO4S and a molecular weight of 221.28 g/mol. Its IUPAC name is methyl N-[(2S,3S,5S)-2-hydroxy-4-oxo-5-sulfanylhexan-3-yl]carbamate.
| Compound Name | methyl N-[(2S,3S,5S)-2-hydroxy-4-oxo-5-sulfanylhexan-3-yl]carbamate |
|---|---|
| PubChem CID | 153093857 |
| Molecular Formula | C8H15NO4S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | methyl N-[(2S,3S,5S)-2-hydroxy-4-oxo-5-sulfanylhexan-3-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)[C@H](C)S)[C@H](C)O |
| InChI | InChI=1S/C8H15NO4S/c1-4(10)6(7(11)5(2)14)9-8(12)13-3/h4-6,10,14H,1-3H3,(H,9,12)/t4-,5-,6-/m0/s1 |
| InChIKey | VPSCQQJDJCJFOD-ZLUOBGJFSA-N |
| XLogP | -0.02 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|