C13H10IN5 — CID 123610590
6-(iodomethyl)-2-pyrazin-2-ylquinazolin-4-amine (PubChem CID 123610590) has the molecular formula C13H10IN5 and a molecular weight of 363.16 g/mol. Its IUPAC name is 6-(iodomethyl)-2-pyrazin-2-ylquinazolin-4-amine.
| Compound Name | 6-(iodomethyl)-2-pyrazin-2-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 123610590 |
| Molecular Formula | C13H10IN5 |
| Molecular Weight | 363.16 g/mol |
| Exact Mass | 363.00 |
| IUPAC Name | 6-(iodomethyl)-2-pyrazin-2-ylquinazolin-4-amine |
| SMILES | Nc1nc(-c2cnccn2)nc2ccc(CI)cc12 |
| InChI | InChI=1S/C13H10IN5/c14-6-8-1-2-10-9(5-8)12(15)19-13(18-10)11-7-16-3-4-17-11/h1-5,7H,6H2,(H2,15,18,19) |
| InChIKey | KTHIZAQCMCRVNA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.16 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|