C25H31N7O — CID 123610889
1-[(Z)-hept-4-en-3-ylidene]-3-[1-[4-(2-methylpyrazol-3-yl)phthalazin-1-yl]piperidin-4-yl]urea (PubChem CID 123610889) has the molecular formula C25H31N7O and a molecular weight of 445.57 g/mol. Its IUPAC name is 1-[(Z)-hept-4-en-3-ylidene]-3-[1-[4-(2-methylpyrazol-3-yl)phthalazin-1-yl]piperidin-4-yl]urea.
| Compound Name | 1-[(Z)-hept-4-en-3-ylidene]-3-[1-[4-(2-methylpyrazol-3-yl)phthalazin-1-yl]piperidin-4-yl]urea |
|---|---|
| PubChem CID | 123610889 |
| Molecular Formula | C25H31N7O |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | 1-[(Z)-hept-4-en-3-ylidene]-3-[1-[4-(2-methylpyrazol-3-yl)phthalazin-1-yl]piperidin-4-yl]urea |
| SMILES | CC/C=C\C(CC)=NC(=O)NC1CCN(c2nnc(-c3ccnn3C)c3ccccc23)CC1 |
| InChI | InChI=1S/C25H31N7O/c1-4-6-9-18(5-2)27-25(33)28-19-13-16-32(17-14-19)24-21-11-8-7-10-20(21)23(29-30-24)22-12-15-26-31(22)3/h6-12,15,19H,4-5,13-14,16-17H2,1-3H3,(H,28,33)/b9-6-,27-18? |
| InChIKey | BJSLCJICYGCUPC-LIXBFLFPSA-N |
| XLogP | 4.53 |
| TPSA | 88.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|