C26H25N7O — CID 59627396
2-cyano-N-methyl-N-[1-[4-(2-methylpyrazol-3-yl)phthalazin-1-yl]piperidin-4-yl]benzamide (PubChem CID 59627396) has the molecular formula C26H25N7O and a molecular weight of 451.53 g/mol. Its IUPAC name is 2-cyano-N-methyl-N-[1-[4-(2-methylpyrazol-3-yl)phthalazin-1-yl]piperidin-4-yl]benzamide.
| Compound Name | 2-cyano-N-methyl-N-[1-[4-(2-methylpyrazol-3-yl)phthalazin-1-yl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 59627396 |
| Molecular Formula | C26H25N7O |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 2-cyano-N-methyl-N-[1-[4-(2-methylpyrazol-3-yl)phthalazin-1-yl]piperidin-4-yl]benzamide |
| SMILES | CN(C(=O)c1ccccc1C#N)C1CCN(c2nnc(-c3ccnn3C)c3ccccc23)CC1 |
| InChI | InChI=1S/C26H25N7O/c1-31(26(34)20-8-4-3-7-18(20)17-27)19-12-15-33(16-13-19)25-22-10-6-5-9-21(22)24(29-30-25)23-11-14-28-32(23)2/h3-11,14,19H,12-13,15-16H2,1-2H3 |
| InChIKey | PGRHHIJWLYVHIV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 90.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |