C17H20N6 — CID 59627409
1-[4-(2-methylpyrazol-3-yl)phthalazin-1-yl]piperidin-4-amine (PubChem CID 59627409) has the molecular formula C17H20N6 and a molecular weight of 308.39 g/mol. Its IUPAC name is 1-[4-(2-methylpyrazol-3-yl)phthalazin-1-yl]piperidin-4-amine.
| Compound Name | 1-[4-(2-methylpyrazol-3-yl)phthalazin-1-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 59627409 |
| Molecular Formula | C17H20N6 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 1-[4-(2-methylpyrazol-3-yl)phthalazin-1-yl]piperidin-4-amine |
| SMILES | Cn1nccc1-c1nnc(N2CCC(N)CC2)c2ccccc12 |
| InChI | InChI=1S/C17H20N6/c1-22-15(6-9-19-22)16-13-4-2-3-5-14(13)17(21-20-16)23-10-7-12(18)8-11-23/h2-6,9,12H,7-8,10-11,18H2,1H3 |
| InChIKey | FEDJWFIRPKBGPE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |